| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C23H20N9O4Br |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2OCOc2c2)c2Br)=O)c1CN(CCC1)c2c1cccc2 |
| InChI | InChI=1S/C23H20BrN9O4/c24-15-9-19-18(35-12-36-19)8-14(15)10-26-28-23(34)20-17(33(31-27-20)22-21(25)29-37-30-22)11-32-7-3-5-13-4-1-2-6-16(13)32/h1-2,4,6,8-10H,3,5,7,11-12H2,(H2,25,29)(H,28,34) |
| InChIK | KOGSRABPDINPQR-UHFFFAOYSA-N |
| TotalMolweight | 566.375 |
| Molweight | 566.375 |
| MonoisotopicMass | 565.082162 |
| CLogP | 4.3799 |
| CLogS | -4.975 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 379.69 |
| Relative PSA | 0.36791 |
| PolarSurfaceArea | 158.81 |
| Druglikeness | 0.59018 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 6 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 8 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-5-(3,4-dihydro-2H-quinolin-1-ylmethyl)triazole-4-carboxamide