| MolName | 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one |
| MolecularFormula | C17H10N4OCl2 |
| Smiles | O=C(c([nH]c1c2cccc1)c2N=C1)N1/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C17H10Cl2N4O/c18-11-6-5-10(13(19)7-11)8-21-23-9-20-15-12-3-1-2-4-14(12)22-16(15)17(23)24/h1-9,22H |
| InChIK | KOPLJFBRFJZMEN-UHFFFAOYSA-N |
| TotalMolweight | 357.199 |
| Molweight | 357.199 |
| MonoisotopicMass | 356.023165 |
| CLogP | 3.7774 |
| CLogS | -5.82 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 252.1 |
| Relative PSA | 0.21261 |
| PolarSurfaceArea | 60.82 |
| Druglikeness | 5.2974 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one | 2 - 3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5H-pyrimido[5,4-b]indol-4-one