| MolName | 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
| MolecularFormula | C18H14N5O3ClS3 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CSc2nnc(SCc(cc3)ccc3Cl)s2)=O)cc1)=O |
| InChI | InChI=1S/C18H14ClN5O3S3/c19-14-5-1-13(2-6-14)10-28-17-22-23-18(30-17)29-11-16(25)21-20-9-12-3-7-15(8-4-12)24(26)27/h1-9H,10-11H2,(H,21,25) |
| InChIK | KOTMOTXSLRKGNB-UHFFFAOYSA-N |
| TotalMolweight | 479.992 |
| Molweight | 479.992 |
| MonoisotopicMass | 478.994727 |
| CLogP | 4.0974 |
| CLogS | -7.536 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 341.8 |
| Relative PSA | 0.42045 |
| PolarSurfaceArea | 191.9 |
| Druglikeness | 0.013968 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide | 2 - 2-[[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide