| MolName | [4-bromo-2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C23H16N3O4BrCl2 |
| Smiles | O=C(CNC(c(cc1)cc(Cl)c1Cl)=O)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C23H16BrCl2N3O4/c24-17-7-9-20(33-23(32)14-4-2-1-3-5-14)16(10-17)12-28-29-21(30)13-27-22(31)15-6-8-18(25)19(26)11-15/h1-12H,13H2,(H,27,31)(H,29,30) |
| InChIK | KPDDMHBFECVXIX-UHFFFAOYSA-N |
| TotalMolweight | 549.207 |
| Molweight | 549.207 |
| MonoisotopicMass | 546.970122 |
| CLogP | 5.653 |
| CLogS | -7.264 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 366.94 |
| Relative PSA | 0.22769 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 3.3116 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] benzoate