| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
| MolecularFormula | C18H13N2O3F7 |
| Smiles | O=C(c(cc(cc1)OCC(F)(F)F)c1OCC(F)(F)F)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C18H13F7N2O3/c19-12-3-1-11(2-4-12)8-26-27-16(28)14-7-13(29-9-17(20,21)22)5-6-15(14)30-10-18(23,24)25/h1-8H,9-10H2,(H,27,28) |
| InChIK | KPLUVFCENSWMCC-UHFFFAOYSA-N |
| TotalMolweight | 438.298 |
| Molweight | 438.298 |
| MonoisotopicMass | 438.081439 |
| CLogP | 4.9436 |
| CLogS | -6.151 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 299.78 |
| Relative PSA | 0.18684 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | -2.7024 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 9 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]-2,5-bis(2,2,2-trifluoroethoxy)benzamide