| MolName | N-[(Z)-thiophen-3-ylmethylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C9H10N2OS |
| Smiles | O=C(C1CC1)N/N=C\c1cscc1 |
| InChI | InChI=1S/C9H10N2OS/c12-9(8-1-2-8)11-10-5-7-3-4-13-6-7/h3-6,8H,1-2H2,(H,11,12) |
| InChIK | KPTCUWUBWOWJTE-UHFFFAOYSA-N |
| TotalMolweight | 194.257 |
| Molweight | 194.257 |
| MonoisotopicMass | 194.051383 |
| CLogP | 1.8603 |
| CLogS | -2.967 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 149.69 |
| Relative PSA | 0.37658 |
| PolarSurfaceArea | 69.7 |
| Druglikeness | 6.0329 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 3 |
| Symmetricatoms | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-thiophen-3-ylmethylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-thiophen-3-ylmethylideneamino]cyclopropanecarboxamide