| MolName | N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(1,1,2,2-tetrafluoroethyl)benzamide |
| MolecularFormula | C18H15N3O3F4 |
| Smiles | NC(COc1ccc(/C=N\NC(c2ccc(C(C(F)F)(F)F)cc2)=O)cc1)=O |
| InChI | InChI=1S/C18H15F4N3O3/c19-17(20)18(21,22)13-5-3-12(4-6-13)16(27)25-24-9-11-1-7-14(8-2-11)28-10-15(23)26/h1-9,17H,10H2,(H2,23,26)(H,25,27) |
| InChIK | KPUVQMDFFOLYQW-UHFFFAOYSA-N |
| TotalMolweight | 397.327 |
| Molweight | 397.327 |
| MonoisotopicMass | 397.104954 |
| CLogP | 2.54 |
| CLogS | -4.4 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 285.33 |
| Relative PSA | 0.26047 |
| PolarSurfaceArea | 93.78 |
| Druglikeness | -5.8283 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(1,1,2,2-tetrafluoroethyl)benzamide | 2 - N-[(Z)-[4-(2-amino-2-oxoethoxy)phenyl]methylideneamino]-4-(1,1,2,2-tetrafluoroethyl)benzamide