| MolName | (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| MolecularFormula | C24H24N8O7 |
| Smiles | Nc1ncnc2c1nc(N/N=C\c(cccc1)c1OCc(cc1)ccc1[N+]([O-])=O)n2[C@H]([C@H]1O)O[C@@H](CO)[C@@H]1O |
| InChI | InChI=1S/C24H24N8O7/c25-21-18-22(27-12-26-21)31(23-20(35)19(34)17(10-33)39-23)24(29-18)30-28-9-14-3-1-2-4-16(14)38-11-13-5-7-15(8-6-13)32(36)37/h1-9,12,17,19-20,23,33-35H,10-11H2,(H,29,30)(H2,25,26,27)/t17-,19-,20+,23+/m1/s1 |
| InChIK | KPWUCVZKBLNBIL-DBBLALLESA-N |
| TotalMolweight | 536.504 |
| Molweight | 536.504 |
| MonoisotopicMass | 536.176797 |
| CLogP | 2.0673 |
| CLogS | -5.93 |
| H Acceptors | 15 |
| H Donors | 5 |
| TotalSurfaceArea | 384.34 |
| Relative PSA | 0.43644 |
| PolarSurfaceArea | 218.98 |
| Druglikeness | -3.7194 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51282 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 15 |
| Electronegative Atoms | 15 |
| StereoCenters | 4 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 12 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol | 2 - (2S,3S,4R,5S)-2-[6-amino-8-[(2Z)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylidene]hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol