| MolName | 2-[[5-nitro-2-[(2E)-2-[[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid |
| MolecularFormula | C29H24N6O6S |
| Smiles | [O-][N+](c(cc1)cc(S(Nc(cccc2)c2C(O)=O)(=O)=O)c1N/N=C/c(cc1)ccc1N(CC1)N=C1c1ccccc1)=O |
| InChI | InChI=1S/C29H24N6O6S/c36-29(37)24-8-4-5-9-26(24)33-42(40,41)28-18-23(35(38)39)14-15-27(28)31-30-19-20-10-12-22(13-11-20)34-17-16-25(32-34)21-6-2-1-3-7-21/h1-15,18-19,31,33H,16-17H2,(H,36,37) |
| InChIK | KQJRVVQSIRWALD-UHFFFAOYSA-N |
| TotalMolweight | 584.612 |
| Molweight | 584.612 |
| MonoisotopicMass | 584.147804 |
| CLogP | 5.6497 |
| CLogS | -6.794 |
| H Acceptors | 12 |
| H Donors | 3 |
| TotalSurfaceArea | 423.86 |
| Relative PSA | 0.31763 |
| PolarSurfaceArea | 177.66 |
| Druglikeness | 0.86772 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52381 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 5 |
| Symmetricatoms | 5 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[5-nitro-2-[(2E)-2-[[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid | 2 - 2-[[5-nitro-2-[(2E)-2-[[4-(5-phenyl-3,4-dihydropyrazol-2-yl)phenyl]methylidene]hydrazinyl]phenyl]sulfonylamino]benzoic acid