| MolName | 1-benzyl-3-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiourea |
| MolecularFormula | C16H14N3O2ClS |
| Smiles | S=C(NCc1ccccc1)N/N=C\c(cc1OCOc1c1)c1Cl |
| InChI | InChI=1S/C16H14ClN3O2S/c17-13-7-15-14(21-10-22-15)6-12(13)9-19-20-16(23)18-8-11-4-2-1-3-5-11/h1-7,9H,8,10H2,(H2,18,20,23) |
| InChIK | KQLNQHZWQXEHOY-UHFFFAOYSA-N |
| TotalMolweight | 347.825 |
| Molweight | 347.825 |
| MonoisotopicMass | 347.049524 |
| CLogP | 4.019 |
| CLogS | -5.584 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 262.85 |
| Relative PSA | 0.3136 |
| PolarSurfaceArea | 86.97 |
| Druglikeness | 2.4968 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-benzyl-3-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiourea | 2 - 1-benzyl-3-[(Z)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiourea