| MolName | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| MolecularFormula | C28H21N5O6 |
| Smiles | [O-][N+](c(cc1)ccc1-n1c(/C=N\NC(/C(/NC(c2ccccc2)=O)=C\c(cc2)cc3c2OCO3)=O)ccc1)=O |
| InChI | InChI=1S/C28H21N5O6/c34-27(20-5-2-1-3-6-20)30-24(15-19-8-13-25-26(16-19)39-18-38-25)28(35)31-29-17-23-7-4-14-32(23)21-9-11-22(12-10-21)33(36)37/h1-17H,18H2,(H,30,34)(H,31,35) |
| InChIK | KQVKWPCBEDOXCO-UHFFFAOYSA-N |
| TotalMolweight | 523.504 |
| Molweight | 523.504 |
| MonoisotopicMass | 523.149185 |
| CLogP | 4.247 |
| CLogS | -8.974 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 393.56 |
| Relative PSA | 0.29932 |
| PolarSurfaceArea | 139.77 |
| Druglikeness | 1.777 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide | 2 - N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2Z)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide