| MolName | 4-bromo-N-[(Z)-furan-2-ylmethylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| MolecularFormula | C16H12N5O4Br |
| Smiles | [O-][N+](c1ccc(Cn2nc(C(N/N=C\c3ccco3)=O)c(Br)c2)cc1)=O |
| InChI | InChI=1S/C16H12BrN5O4/c17-14-10-21(9-11-3-5-12(6-4-11)22(24)25)20-15(14)16(23)19-18-8-13-2-1-7-26-13/h1-8,10H,9H2,(H,19,23) |
| InChIK | KQWJAZLIYMQSIJ-UHFFFAOYSA-N |
| TotalMolweight | 418.206 |
| Molweight | 418.206 |
| MonoisotopicMass | 417.007266 |
| CLogP | 1.6677 |
| CLogS | -4.278 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 280.46 |
| Relative PSA | 0.35078 |
| PolarSurfaceArea | 118.24 |
| Druglikeness | -3.5284 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65385 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-N-[(Z)-furan-2-ylmethylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide | 2 - 4-bromo-N-[(Z)-furan-2-ylmethylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide