| MolName | (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(2,4-dichlorophenyl)methanimine |
| MolecularFormula | C21H15N5Cl2S |
| Smiles | Clc1cc(Cl)c(/C=N\n2c(SCc3ccccc3)nnc2-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H15Cl2N5S/c22-18-7-6-17(19(23)12-18)13-25-28-20(16-8-10-24-11-9-16)26-27-21(28)29-14-15-4-2-1-3-5-15/h1-13H,14H2 |
| InChIK | KQWVCKIENBHDHT-UHFFFAOYSA-N |
| TotalMolweight | 440.357 |
| Molweight | 440.357 |
| MonoisotopicMass | 439.042519 |
| CLogP | 5.2859 |
| CLogS | -9.33 |
| H Acceptors | 5 |
| TotalSurfaceArea | 324.87 |
| Relative PSA | 0.21172 |
| PolarSurfaceArea | 81.26 |
| Druglikeness | 3.7744 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51724 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(2,4-dichlorophenyl)methanimine | 2 - (Z)-N-(3-benzylsulfanyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)-1-(2,4-dichlorophenyl)methanimine