| MolName | N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C23H18N6O4S |
| Smiles | [O-][N+](c1cccc(-c(n2-c3ccccc3)nnc2SCC(N/N=C\c2cc(O)ccc2)=O)c1)=O |
| InChI | InChI=1S/C23H18N6O4S/c30-20-11-4-6-16(12-20)14-24-25-21(31)15-34-23-27-26-22(28(23)18-8-2-1-3-9-18)17-7-5-10-19(13-17)29(32)33/h1-14,30H,15H2,(H,25,31) |
| InChIK | KQZGYKIEIRZWIW-UHFFFAOYSA-N |
| TotalMolweight | 474.5 |
| Molweight | 474.5 |
| MonoisotopicMass | 474.111024 |
| CLogP | 3.2645 |
| CLogS | -8.58 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 354.5 |
| Relative PSA | 0.35495 |
| PolarSurfaceArea | 163.52 |
| Druglikeness | 0.29732 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-(3-hydroxyphenyl)methylideneamino]-2-[[5-(3-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide