| MolName | [2-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-2-sulfonate |
| MolecularFormula | C31H24N2O5S |
| Smiles | OC(C(N/N=C\c(cccc1)c1OS(c1cc2ccccc2cc1)(=O)=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H24N2O5S/c34-30(31(35,26-14-3-1-4-15-26)27-16-5-2-6-17-27)33-32-22-25-13-9-10-18-29(25)38-39(36,37)28-20-19-23-11-7-8-12-24(23)21-28/h1-22,35H,(H,33,34) |
| InChIK | KREGJWCBAMRGOX-UHFFFAOYSA-N |
| TotalMolweight | 536.607 |
| Molweight | 536.607 |
| MonoisotopicMass | 536.140593 |
| CLogP | 5.5552 |
| CLogS | -6.807 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 396.45 |
| Relative PSA | 0.22119 |
| PolarSurfaceArea | 113.44 |
| Druglikeness | 7.5979 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.48718 |
| Fragments | 1 |
| Non HAtoms | 39 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 4 |
| Symmetricatoms | 9 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-2-sulfonate | 2 - [2-[(Z)-[(2-hydroxy-2,2-diphenylacetyl)hydrazinylidene]methyl]phenyl] naphthalene-2-sulfonate