| MolName | 4-fluoro-N-[4-(4-fluorophenyl)-2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide |
| MolecularFormula | C23H15N5O3F2S |
| Smiles | [O-][N+](c1cccc(/C=N\Nc2nc(-c(cc3)ccc3F)c(NC(c(cc3)ccc3F)=O)s2)c1)=O |
| InChI | InChI=1S/C23H15F2N5O3S/c24-17-8-4-15(5-9-17)20-22(28-21(31)16-6-10-18(25)11-7-16)34-23(27-20)29-26-13-14-2-1-3-19(12-14)30(32)33/h1-13H,(H,27,29)(H,28,31) |
| InChIK | KRPGFJCKMJCXTK-UHFFFAOYSA-N |
| TotalMolweight | 479.466 |
| Molweight | 479.466 |
| MonoisotopicMass | 479.086366 |
| CLogP | 6.6631 |
| CLogS | -7.41 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 349.04 |
| Relative PSA | 0.31292 |
| PolarSurfaceArea | 140.44 |
| Druglikeness | -2.501 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-fluoro-N-[4-(4-fluorophenyl)-2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide | 2 - 4-fluoro-N-[4-(4-fluorophenyl)-2-[(2Z)-2-[(3-nitrophenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]benzamide