| MolName | N-[2-(morpholine-4-carbonyl)phenyl]-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C27H26N4O5 |
| Smiles | O=C(C(N/N=C\c(cccc1)c1OCc1ccccc1)=O)Nc(cccc1)c1C(N1CCOCC1)=O |
| InChI | InChI=1S/C27H26N4O5/c32-25(29-23-12-6-5-11-22(23)27(34)31-14-16-35-17-15-31)26(33)30-28-18-21-10-4-7-13-24(21)36-19-20-8-2-1-3-9-20/h1-13,18H,14-17,19H2,(H,29,32)(H,30,33) |
| InChIK | KRSCJARXIGYFOW-UHFFFAOYSA-N |
| TotalMolweight | 486.526 |
| Molweight | 486.526 |
| MonoisotopicMass | 486.190321 |
| CLogP | 3.1663 |
| CLogS | -4.576 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 379.31 |
| Relative PSA | 0.25599 |
| PolarSurfaceArea | 109.33 |
| Druglikeness | 5.0059 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.58333 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 7 |
| Symmetricatoms | 4 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-(morpholine-4-carbonyl)phenyl]-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide | 2 - N-[2-(morpholine-4-carbonyl)phenyl]-N'-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]oxamide