| MolName | 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]acetamide |
| MolecularFormula | C22H16N6OClFS |
| Smiles | O=C(CSc1nnc(-c2ccncc2)n1-c(cc1)ccc1Cl)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C22H16ClFN6OS/c23-17-3-7-19(8-4-17)30-21(16-9-11-25-12-10-16)28-29-22(30)32-14-20(31)27-26-13-15-1-5-18(24)6-2-15/h1-13H,14H2,(H,27,31) |
| InChIK | KRTBCWLTCCUXLL-UHFFFAOYSA-N |
| TotalMolweight | 466.927 |
| Molweight | 466.927 |
| MonoisotopicMass | 466.077884 |
| CLogP | 4.2377 |
| CLogS | -8.671 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 345.01 |
| Relative PSA | 0.27037 |
| PolarSurfaceArea | 110.36 |
| Druglikeness | 4.1089 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]acetamide | 2 - 2-[[4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-fluorophenyl)methylideneamino]acetamide