| MolName | 2-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-chloro-6-nitrophenolate |
| MolecularFormula | C15H9N3O5BrCl2 |
| Smiles | [O-]c(c([N+]([O-])=O)c1)c(/C=N\NC(COc(ccc(Cl)c2)c2Br)=O)cc1Cl |
| InChI | InChI=1S/C15H10BrCl2N3O5/c16-11-4-9(17)1-2-13(11)26-7-14(22)20-19-6-8-3-10(18)5-12(15(8)23)21(24)25/h1-6,23H,7H2,(H,20,22)/p-1 |
| InChIK | KRXNPUCGIUTGGZ-UHFFFAOYSA-M |
| TotalMolweight | 462.062 |
| Molweight | 462.062 |
| MonoisotopicMass | 459.910262 |
| CLogP | 1.8684 |
| CLogS | -5.971 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 291.42 |
| Relative PSA | 0.31127 |
| PolarSurfaceArea | 119.57 |
| Druglikeness | -2.6779 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61538 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 4 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-chloro-6-nitrophenolate | 2 - 2-[(Z)-[[2-(2-bromo-4-chlorophenoxy)acetyl]hydrazinylidene]methyl]-4-chloro-6-nitrophenolate