| MolName | [4-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| MolecularFormula | C21H15N3O4Cl2S |
| Smiles | O=C(CNC(c(cc1)cc(Cl)c1Cl)=O)N/N=C\c(cc1)ccc1OC(c1cccs1)=O |
| InChI | InChI=1S/C21H15Cl2N3O4S/c22-16-8-5-14(10-17(16)23)20(28)24-12-19(27)26-25-11-13-3-6-15(7-4-13)30-21(29)18-2-1-9-31-18/h1-11H,12H2,(H,24,28)(H,26,27) |
| InChIK | KRXSNVCIZAVEAL-UHFFFAOYSA-N |
| TotalMolweight | 476.339 |
| Molweight | 476.339 |
| MonoisotopicMass | 475.016031 |
| CLogP | 4.7944 |
| CLogS | -6.44 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 344.25 |
| Relative PSA | 0.30184 |
| PolarSurfaceArea | 125.1 |
| Druglikeness | 6.9594 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate | 2 - [4-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate