| MolName | 2-(2-bromo-4-chlorophenoxy)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]acetamide |
| MolecularFormula | C13H9N2O3BrClI |
| Smiles | O=C(COc(ccc(Cl)c1)c1Br)N/N=C\c(o1)ccc1I |
| InChI | InChI=1S/C13H9BrClIN2O3/c14-10-5-8(15)1-3-11(10)20-7-13(19)18-17-6-9-2-4-12(16)21-9/h1-6H,7H2,(H,18,19) |
| InChIK | KSDOXJPAWCEWEI-UHFFFAOYSA-N |
| TotalMolweight | 483.482 |
| Molweight | 483.482 |
| MonoisotopicMass | 481.852979 |
| CLogP | 3.8309 |
| CLogS | -5.532 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 260.77 |
| Relative PSA | 0.23055 |
| PolarSurfaceArea | 63.83 |
| Druglikeness | 5.0287 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-bromo-4-chlorophenoxy)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]acetamide | 2 - 2-(2-bromo-4-chlorophenoxy)-N-[(Z)-(5-iodofuran-2-yl)methylideneamino]acetamide