4-[(Z)-[[4-[(4-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid
Formula:C20H15N4O6ClS
Mutagenic:none
Tumorigenic:none
Reproductive Effective:none
4-[(Z)-[[4-[(4-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid is a drug-like molecule.
| MolName | 4-[(Z)-[[4-[(4-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C20H15N4O6ClS |
| Smiles | [O-][N+](c(cc(cc1)S(Nc(cc2)ccc2Cl)(=O)=O)c1N/N=C\c(cc1)ccc1C(O)=O)=O |
| InChI | InChI=1S/C20H15ClN4O6S/c21-15-5-7-16(8-6-15)24-32(30,31)17-9-10-18(19(11-17)25(28)29)23-22-12-13-1-3-14(4-2-13)20(26)27/h1-12,23-24H,(H,26,27) |
| InChIK | KSLAOSQHOYZLJK-UHFFFAOYSA-N |
| TotalMolweight | 474.88 |
| Molweight | 474.88 |
| MonoisotopicMass | 474.040083 |
| CLogP | 4.3095 |
| CLogS | -5.691 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 332.23 |
| Relative PSA | 0.3599 |
| PolarSurfaceArea | 162.06 |
| Druglikeness | -8.0455 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| Amides | 1 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[4-[(4-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[[4-[(4-chlorophenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]benzoic acid
Spacefill |
Wire |
Ball & Stick |
Iso-vdw |
Opaque |
Dot Surface |
Mep |
Translucent |
Spin |
Label On |
Off