| MolName | 3-benzyl-N-[(Z)-benzylideneamino]-4-oxophthalazine-1-carboxamide |
| MolecularFormula | C23H18N4O2 |
| Smiles | O=C(C(c1c2cccc1)=NN(Cc1ccccc1)C2=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C23H18N4O2/c28-22(25-24-15-17-9-3-1-4-10-17)21-19-13-7-8-14-20(19)23(29)27(26-21)16-18-11-5-2-6-12-18/h1-15H,16H2,(H,25,28) |
| InChIK | KSSYGVPAGVKRTL-UHFFFAOYSA-N |
| TotalMolweight | 382.422 |
| Molweight | 382.422 |
| MonoisotopicMass | 382.142976 |
| CLogP | 3.6821 |
| CLogS | -5.38 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 298.03 |
| Relative PSA | 0.21511 |
| PolarSurfaceArea | 74.13 |
| Druglikeness | 7.4745 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 3-benzyl-N-[(Z)-benzylideneamino]-4-oxophthalazine-1-carboxamide | 2 - 3-benzyl-N-[(Z)-benzylideneamino]-4-oxophthalazine-1-carboxamide