| MolName | N-[(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide |
| MolecularFormula | C24H19N4O3I |
| Smiles | [O-][N+](c1ccc(CC(N/N=C\c2cn(Cc(cc3)ccc3I)c3c2cccc3)=O)cc1)=O |
| InChI | InChI=1S/C24H19IN4O3/c25-20-9-5-18(6-10-20)15-28-16-19(22-3-1-2-4-23(22)28)14-26-27-24(30)13-17-7-11-21(12-8-17)29(31)32/h1-12,14,16H,13,15H2,(H,27,30) |
| InChIK | KSTHXZDLNCLUCC-UHFFFAOYSA-N |
| TotalMolweight | 538.34 |
| Molweight | 538.34 |
| MonoisotopicMass | 538.050189 |
| CLogP | 4.2449 |
| CLogS | -6.14 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 348.02 |
| Relative PSA | 0.21062 |
| PolarSurfaceArea | 92.21 |
| Druglikeness | 1.3617 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide | 2 - N-[(Z)-[1-[(4-iodophenyl)methyl]indol-3-yl]methylideneamino]-2-(4-nitrophenyl)acetamide