| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C28H24N9O3Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cccc(OCc(cccc3)c3Cl)c2)=O)c1CN(CC1)c2c1cccc2 |
| InChI | InChI=1S/C28H24ClN9O3/c29-22-10-3-1-8-20(22)17-40-21-9-5-6-18(14-21)15-31-33-28(39)25-24(38(36-32-25)27-26(30)34-41-35-27)16-37-13-12-19-7-2-4-11-23(19)37/h1-11,14-15H,12-13,16-17H2,(H2,30,34)(H,33,39) |
| InChIK | KSWVKHHLVPDYDH-UHFFFAOYSA-N |
| TotalMolweight | 570.012 |
| Molweight | 570.012 |
| MonoisotopicMass | 569.169063 |
| CLogP | 5.1554 |
| CLogS | -5.237 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 425.98 |
| Relative PSA | 0.30445 |
| PolarSurfaceArea | 149.58 |
| Druglikeness | 3.1871 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[3-[(2-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(2,3-dihydroindol-1-ylmethyl)triazole-4-carboxamide