| MolName | 3-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoic acid |
| MolecularFormula | C23H18N2O5 |
| Smiles | OC(c1cccc(-c2ccc(/C=N\N(C([C@H]([C@H]34)[C@@H]5C=C[C@H]4C54CC4)=O)C3=O)o2)c1)=O |
| InChI | InChI=1S/C23H18N2O5/c26-20-18-15-5-6-16(23(15)8-9-23)19(18)21(27)25(20)24-11-14-4-7-17(30-14)12-2-1-3-13(10-12)22(28)29/h1-7,10-11,15-16,18-19H,8-9H2,(H,28,29)/t15-,16+,18-,19-/m1/s1 |
| InChIK | KSYBQTNHXKOQCW-UKBAYJJMSA-N |
| TotalMolweight | 402.405 |
| Molweight | 402.405 |
| MonoisotopicMass | 402.121573 |
| CLogP | 2.4701 |
| CLogS | -5.164 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 277.8 |
| Relative PSA | 0.29298 |
| PolarSurfaceArea | 100.18 |
| Druglikeness | 7.2119 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 7 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 8 |
| Symmetricatoms | 1 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 3-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoic acid | 2 - 3-[5-[(Z)-[(1R,2R,6S,7S)-3,5-dioxospiro[4-azatricyclo[5.2.1.02,6]dec-8-ene-10,1'-cyclopropane]-4-yl]iminomethyl]furan-2-yl]benzoic acid