| MolName | 4-chloro-2-[(Z)-morpholin-4-yliminomethyl]-6-nitrophenolate |
| MolecularFormula | C11H11N3O4Cl |
| Smiles | [O-]c(c(/C=N\N1CCOCC1)cc(Cl)c1)c1[N+]([O-])=O |
| InChI | InChI=1S/C11H12ClN3O4/c12-9-5-8(11(16)10(6-9)15(17)18)7-13-14-1-3-19-4-2-14/h5-7,16H,1-4H2/p-1 |
| InChIK | KTBNANPMPYLFDB-UHFFFAOYSA-M |
| TotalMolweight | 284.678 |
| Molweight | 284.678 |
| MonoisotopicMass | 284.043809 |
| CLogP | -0.7478 |
| CLogS | -2.731 |
| H Acceptors | 7 |
| TotalSurfaceArea | 206.48 |
| Relative PSA | 0.33785 |
| PolarSurfaceArea | 93.71 |
| Druglikeness | -2.3042 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-2-[(Z)-morpholin-4-yliminomethyl]-6-nitrophenolate | 2 - 4-chloro-2-[(Z)-morpholin-4-yliminomethyl]-6-nitrophenolate