| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide |
| MolecularFormula | C21H15N4OF |
| Smiles | O=C(c1cc(-c2cc3ccccc3cc2)n[nH]1)N/N=C\c(cc1)ccc1F |
| InChI | InChI=1S/C21H15FN4O/c22-18-9-5-14(6-10-18)13-23-26-21(27)20-12-19(24-25-20)17-8-7-15-3-1-2-4-16(15)11-17/h1-13H,(H,24,25)(H,26,27) |
| InChIK | KTCRQENSDCARLN-UHFFFAOYSA-N |
| TotalMolweight | 358.375 |
| Molweight | 358.375 |
| MonoisotopicMass | 358.122989 |
| CLogP | 4.1946 |
| CLogS | -6.016 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 276.03 |
| Relative PSA | 0.22088 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 4.2921 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]-3-naphthalen-2-yl-1H-pyrazole-5-carboxamide