| MolName | (Z)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine |
| MolecularFormula | C13H8N4OCl2 |
| Smiles | Clc(cc1)cc(-c2ccc(/C=N\c3ncn[nH]3)o2)c1Cl |
| InChI | InChI=1S/C13H8Cl2N4O/c14-8-1-3-11(15)10(5-8)12-4-2-9(20-12)6-16-13-17-7-18-19-13/h1-7H,(H,17,18,19) |
| InChIK | KTELCJHOASDSAF-UHFFFAOYSA-N |
| TotalMolweight | 307.14 |
| Molweight | 307.14 |
| MonoisotopicMass | 306.007515 |
| CLogP | 3.3237 |
| CLogS | -5.311 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 225.16 |
| Relative PSA | 0.27336 |
| PolarSurfaceArea | 67.07 |
| Druglikeness | 4.4149 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine | 2 - (Z)-1-[5-(2,5-dichlorophenyl)furan-2-yl]-N-(1H-1,2,4-triazol-5-yl)methanimine