| MolName | (Z)-1-[3,4-bis(phenylmethoxy)phenyl]-N-morpholin-4-ylmethanimine |
| MolecularFormula | C25H26N2O3 |
| Smiles | C(c1ccccc1)Oc(ccc(/C=N\N1CCOCC1)c1)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O3/c1-3-7-21(8-4-1)19-29-24-12-11-23(18-26-27-13-15-28-16-14-27)17-25(24)30-20-22-9-5-2-6-10-22/h1-12,17-18H,13-16,19-20H2 |
| InChIK | KTGBTYGVQXCEOX-UHFFFAOYSA-N |
| TotalMolweight | 402.492 |
| Molweight | 402.492 |
| MonoisotopicMass | 402.194343 |
| CLogP | 4.1877 |
| CLogS | -4.513 |
| H Acceptors | 5 |
| TotalSurfaceArea | 326.9 |
| Relative PSA | 0.13784 |
| PolarSurfaceArea | 43.29 |
| Druglikeness | 2.8656 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.53333 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[3,4-bis(phenylmethoxy)phenyl]-N-morpholin-4-ylmethanimine | 2 - (Z)-1-[3,4-bis(phenylmethoxy)phenyl]-N-morpholin-4-ylmethanimine