| MolName | 4-bromo-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| MolecularFormula | C22H14N6O6BrCl |
| Smiles | [O-][N+](c1ccc(Cn2nc(C(N/N=C\c3ccc(-c(cc(cc4)[N+]([O-])=O)c4Cl)o3)=O)c(Br)c2)cc1)=O |
| InChI | InChI=1S/C22H14BrClN6O6/c23-18-12-28(11-13-1-3-14(4-2-13)29(32)33)27-21(18)22(31)26-25-10-16-6-8-20(36-16)17-9-15(30(34)35)5-7-19(17)24/h1-10,12H,11H2,(H,26,31) |
| InChIK | KTQXVHMCOQCHHU-UHFFFAOYSA-N |
| TotalMolweight | 573.746 |
| Molweight | 573.746 |
| MonoisotopicMass | 571.984672 |
| CLogP | 3.1023 |
| CLogS | -7.252 |
| H Acceptors | 12 |
| H Donors | 1 |
| TotalSurfaceArea | 379.31 |
| Relative PSA | 0.33956 |
| PolarSurfaceArea | 164.06 |
| Druglikeness | -1.5026 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.61111 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-bromo-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide | 2 - 4-bromo-N-[(Z)-[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide