| MolName | N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide |
| MolecularFormula | C22H14N2O2ClF7 |
| Smiles | O=C(C(C(C(F)(F)F)(F)F)(F)F)N/N=C\c(c1ccccc1cc1)c1OCc(cccc1)c1Cl |
| InChI | InChI=1S/C22H14ClF7N2O2/c23-17-8-4-2-6-14(17)12-34-18-10-9-13-5-1-3-7-15(13)16(18)11-31-32-19(33)20(24,25)21(26,27)22(28,29)30/h1-11H,12H2,(H,32,33) |
| InChIK | KUBSGZCKEIFBRK-UHFFFAOYSA-N |
| TotalMolweight | 506.804 |
| Molweight | 506.804 |
| MonoisotopicMass | 506.063201 |
| CLogP | 6.8086 |
| CLogS | -8.41 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 336.45 |
| Relative PSA | 0.13675 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | -82.303 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47059 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide | 2 - N-[(Z)-[2-[(2-chlorophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2,2,3,3,4,4,4-heptafluorobutanamide