| MolName | [2-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(furan-2-yl)prop-2-enoate |
| MolecularFormula | C24H18N3O7Br |
| Smiles | O=C(CNC(c(cc1)cc2c1OCO2)=O)N/N=C\c(cc(cc1)Br)c1OC(/C=C/c1ccco1)=O |
| InChI | InChI=1S/C24H18BrN3O7/c25-17-4-7-19(35-23(30)8-5-18-2-1-9-32-18)16(10-17)12-27-28-22(29)13-26-24(31)15-3-6-20-21(11-15)34-14-33-20/h1-12H,13-14H2,(H,26,31)(H,28,29) |
| InChIK | KUGXWHGJQWCJMN-UHFFFAOYSA-N |
| TotalMolweight | 540.325 |
| Molweight | 540.325 |
| MonoisotopicMass | 539.032813 |
| CLogP | 4.0703 |
| CLogS | -6.555 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 372.55 |
| Relative PSA | 0.31582 |
| PolarSurfaceArea | 128.46 |
| Druglikeness | 1.14 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(furan-2-yl)prop-2-enoate | 2 - [2-[(Z)-[[2-(1,3-benzodioxole-5-carbonylamino)acetyl]hydrazinylidene]methyl]-4-bromophenyl] (E)-3-(furan-2-yl)prop-2-enoate