| MolName | N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-chlorophenoxy)acetamide |
| MolecularFormula | C22H18N2O3BrCl |
| Smiles | O=C(COc(cccc1)c1Cl)N/N=C\c(cccc1)c1OCc(cc1)ccc1Br |
| InChI | InChI=1S/C22H18BrClN2O3/c23-18-11-9-16(10-12-18)14-28-20-7-3-1-5-17(20)13-25-26-22(27)15-29-21-8-4-2-6-19(21)24/h1-13H,14-15H2,(H,26,27) |
| InChIK | KUISILNXJQBLBK-UHFFFAOYSA-N |
| TotalMolweight | 473.753 |
| Molweight | 473.753 |
| MonoisotopicMass | 472.018931 |
| CLogP | 5.4558 |
| CLogS | -6.412 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 328.32 |
| Relative PSA | 0.1706 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 2.4378 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | low |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-chlorophenoxy)acetamide | 2 - N-[(Z)-[2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-2-(2-chlorophenoxy)acetamide