| MolName | 4,6-dimorpholin-4-yl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3,5-triazin-2-amine |
| MolecularFormula | C20H25N7O2 |
| Smiles | C(COCC1)N1c1nc(N/N=C\C=C\c2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H25N7O2/c1-2-5-17(6-3-1)7-4-8-21-25-18-22-19(26-9-13-28-14-10-26)24-20(23-18)27-11-15-29-16-12-27/h1-8H,9-16H2,(H,22,23,24,25) |
| InChIK | KUYVQHDGDHQCNU-UHFFFAOYSA-N |
| TotalMolweight | 395.465 |
| Molweight | 395.465 |
| MonoisotopicMass | 395.206973 |
| CLogP | 3.6188 |
| CLogS | -3.833 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 315.7 |
| Relative PSA | 0.26284 |
| PolarSurfaceArea | 88 |
| Druglikeness | 3.3095 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-dimorpholin-4-yl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3,5-triazin-2-amine | 2 - 4,6-dimorpholin-4-yl-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1,3,5-triazin-2-amine