| MolName | N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-[3-[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-adamantyl]acetamide |
| MolecularFormula | C24H26N6O8 |
| Smiles | [O-][N+](c1ccc(/C=N\NC(CC2(CC(C3)C4)CC4(CC(N/N=C\c4ccc([N+]([O-])=O)o4)=O)CC3C2)=O)o1)=O |
| InChI | InChI=1S/C24H26N6O8/c31-19(27-25-12-17-1-3-21(37-17)29(33)34)10-23-6-15-5-16(7-23)9-24(8-15,14-23)11-20(32)28-26-13-18-2-4-22(38-18)30(35)36/h1-4,12-13,15-16H,5-11,14H2,(H,27,31)(H,28,32) |
| InChIK | KUZOCLQVVNXZRU-UHFFFAOYSA-N |
| TotalMolweight | 526.504 |
| Molweight | 526.504 |
| MonoisotopicMass | 526.181214 |
| CLogP | 2.9128 |
| CLogS | -8.324 |
| H Acceptors | 14 |
| H Donors | 2 |
| TotalSurfaceArea | 383.08 |
| Relative PSA | 0.42049 |
| PolarSurfaceArea | 200.84 |
| Druglikeness | 3.3225 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60526 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 14 |
| Electronegative Atoms | 14 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 14 |
| Symmetricatoms | 19 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-[3-[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-adamantyl]acetamide | 2 - N-[(Z)-(5-nitrofuran-2-yl)methylideneamino]-2-[3-[2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxoethyl]-1-adamantyl]acetamide