| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide |
| MolecularFormula | C25H26N9O3Cl |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2OCc2cccc(Cl)c2)=O)c1CN1CCCCC1 |
| InChI | InChI=1S/C25H26ClN9O3/c26-19-6-4-5-18(13-19)16-37-20-9-7-17(8-10-20)14-28-30-25(36)22-21(15-34-11-2-1-3-12-34)35(33-29-22)24-23(27)31-38-32-24/h4-10,13-14H,1-3,11-12,15-16H2,(H2,27,31)(H,30,36) |
| InChIK | KVDIZLAAVIJWGR-UHFFFAOYSA-N |
| TotalMolweight | 535.994 |
| Molweight | 535.994 |
| MonoisotopicMass | 535.184713 |
| CLogP | 4.4594 |
| CLogS | -3.999 |
| H Acceptors | 12 |
| H Donors | 2 |
| TotalSurfaceArea | 407.5 |
| Relative PSA | 0.31826 |
| PolarSurfaceArea | 149.58 |
| Druglikeness | 1.5558 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55263 |
| Fragments | 1 |
| Non HAtoms | 38 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-5-(piperidin-1-ylmethyl)triazole-4-carboxamide