| MolName | 2-[(2Z,5S)-2-[(Z)-benzylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-bromophenyl)acetamide |
| MolecularFormula | C24H19N4O3BrS |
| Smiles | Oc(cc1)ccc1N(C([C@H](CC(Nc(cc1)ccc1Br)=O)S1)=O)/C1=N/N=C\c1ccccc1 |
| InChI | InChI=1S/C24H19BrN4O3S/c25-17-6-8-18(9-7-17)27-22(31)14-21-23(32)29(19-10-12-20(30)13-11-19)24(33-21)28-26-15-16-4-2-1-3-5-16/h1-13,15,21,30H,14H2,(H,27,31)/t21-/m0/s1 |
| InChIK | KVVJBHCZWDXPFH-NRFANRHFSA-N |
| TotalMolweight | 523.41 |
| Molweight | 523.41 |
| MonoisotopicMass | 522.036122 |
| CLogP | 6.2089 |
| CLogS | -6.972 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 353 |
| Relative PSA | 0.26827 |
| PolarSurfaceArea | 119.66 |
| Druglikeness | 4.862 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| Amides | 2 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 2-[(2Z,5S)-2-[(Z)-benzylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-bromophenyl)acetamide | 2 - 2-[(2Z,5S)-2-[(Z)-benzylidenehydrazinylidene]-3-(4-hydroxyphenyl)-4-oxo-1,3-thiazolidin-5-yl]-N-(4-bromophenyl)acetamide