| MolName | N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide |
| MolecularFormula | C23H20N3O2Br |
| Smiles | O=C(CNC(C(c1ccccc1)c1ccccc1)=O)N/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C23H20BrN3O2/c24-20-13-7-8-17(14-20)15-26-27-21(28)16-25-23(29)22(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-15,22H,16H2,(H,25,29)(H,27,28) |
| InChIK | KWCHBZBGLGGFQF-UHFFFAOYSA-N |
| TotalMolweight | 450.335 |
| Molweight | 450.335 |
| MonoisotopicMass | 449.073888 |
| CLogP | 4.5362 |
| CLogS | -5.436 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 320.85 |
| Relative PSA | 0.18859 |
| PolarSurfaceArea | 70.56 |
| Druglikeness | 4.5252 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide | 2 - N-[2-[(2Z)-2-[(3-bromophenyl)methylidene]hydrazinyl]-2-oxoethyl]-2,2-diphenylacetamide