| MolName | 3-[(Z)-(4-bromophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C17H14N3OBrS |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c(cc1)ccc1Br |
| InChI | InChI=1S/C17H14BrN3OS/c18-12-7-5-11(6-8-12)9-20-21-10-19-16-15(17(21)22)13-3-1-2-4-14(13)23-16/h5-10H,1-4H2 |
| InChIK | KWROBLCQHGBNQW-UHFFFAOYSA-N |
| TotalMolweight | 388.288 |
| Molweight | 388.288 |
| MonoisotopicMass | 387.004093 |
| CLogP | 4.4102 |
| CLogS | -5.885 |
| H Acceptors | 4 |
| TotalSurfaceArea | 253.2 |
| Relative PSA | 0.23685 |
| PolarSurfaceArea | 73.27 |
| Druglikeness | -0.46167 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6087 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-(4-bromophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-(4-bromophenyl)methylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one