| MolName | N-[(Z)-benzylideneamino]-2-[2-[(2Z)-2-benzylidenehydrazinyl]-2-oxoethyl]sulfanylacetamide |
| MolecularFormula | C18H18N4O2S |
| Smiles | O=C(CSCC(N/N=C\c1ccccc1)=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S/c23-17(21-19-11-15-7-3-1-4-8-15)13-25-14-18(24)22-20-12-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,21,23)(H,22,24) |
| InChIK | KXBZBEIHDZTADD-UHFFFAOYSA-N |
| TotalMolweight | 354.433 |
| Molweight | 354.433 |
| MonoisotopicMass | 354.115046 |
| CLogP | 3.1846 |
| CLogS | -4.725 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 285.97 |
| Relative PSA | 0.313 |
| PolarSurfaceArea | 108.22 |
| Druglikeness | 4.6685 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.76 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 14 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-benzylideneamino]-2-[2-[(2Z)-2-benzylidenehydrazinyl]-2-oxoethyl]sulfanylacetamide | 2 - N-[(Z)-benzylideneamino]-2-[2-[(2Z)-2-benzylidenehydrazinyl]-2-oxoethyl]sulfanylacetamide