| MolName | N-[(Z)-1H-carbazol-3-ylmethylideneamino]-N-phenylaniline |
| MolecularFormula | C25H19N3 |
| Smiles | C1C2=Nc(cccc3)c3C2=CC(/C=N\N(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C25H19N3/c1-3-9-20(10-4-1)28(21-11-5-2-6-12-21)26-18-19-15-16-25-23(17-19)22-13-7-8-14-24(22)27-25/h1-15,17-18H,16H2 |
| InChIK | KXDTVEGIBFPTMR-UHFFFAOYSA-N |
| TotalMolweight | 361.447 |
| Molweight | 361.447 |
| MonoisotopicMass | 361.157897 |
| CLogP | 4.7923 |
| CLogS | -6.053 |
| H Acceptors | 3 |
| TotalSurfaceArea | 286.99 |
| Relative PSA | 0.092582 |
| PolarSurfaceArea | 27.96 |
| Druglikeness | 3.8522 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1H-carbazol-3-ylmethylideneamino]-N-phenylaniline | 2 - N-[(Z)-1H-carbazol-3-ylmethylideneamino]-N-phenylaniline