| MolName | (Z,E)-3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| MolecularFormula | C9H8N4O |
| Smiles | C(/C=N\n1cnnc1)=C/c1ccco1 |
| InChI | InChI=1S/C9H8N4O/c1(3-9-4-2-6-14-9)5-12-13-7-10-11-8-13/h1-8H |
| InChIK | KXTUPSKHVKCXSB-UHFFFAOYSA-N |
| TotalMolweight | 188.19 |
| Molweight | 188.19 |
| MonoisotopicMass | 188.069811 |
| CLogP | 0.4353 |
| CLogS | -4.284 |
| H Acceptors | 5 |
| TotalSurfaceArea | 160.69 |
| Relative PSA | 0.33873 |
| PolarSurfaceArea | 56.21 |
| Druglikeness | 3.1241 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 14 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z,E)-3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine | 2 - (Z,E)-3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine