| MolName | [4-[(Z)-[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| MolecularFormula | C33H26N2O5 |
| Smiles | O=C(COc(cc1)ccc1OCc1ccccc1)N/N=C\c(cc1)ccc1OC(c1cccc2ccccc12)=O |
| InChI | InChI=1S/C33H26N2O5/c36-32(23-39-28-19-17-27(18-20-28)38-22-25-7-2-1-3-8-25)35-34-21-24-13-15-29(16-14-24)40-33(37)31-12-6-10-26-9-4-5-11-30(26)31/h1-21H,22-23H2,(H,35,36) |
| InChIK | KYDSYVLGCWCDEQ-UHFFFAOYSA-N |
| TotalMolweight | 530.578 |
| Molweight | 530.578 |
| MonoisotopicMass | 530.184173 |
| CLogP | 6.7495 |
| CLogS | -7.918 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 416.38 |
| Relative PSA | 0.18985 |
| PolarSurfaceArea | 86.22 |
| Druglikeness | 3.9689 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.675 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 11 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 5 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[[2-(4-phenylmethoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate