| MolName | 2-(2,4-dichlorophenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H13N3O5Cl2 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\NC(COc(ccc(Cl)c2)c2Cl)=O)o1)=O |
| InChI | InChI=1S/C19H13Cl2N3O5/c20-12-5-7-18(15(21)9-12)28-11-19(25)23-22-10-13-6-8-17(29-13)14-3-1-2-4-16(14)24(26)27/h1-10H,11H2,(H,23,25) |
| InChIK | KYJCAOZXSWQMQJ-UHFFFAOYSA-N |
| TotalMolweight | 434.234 |
| Molweight | 434.234 |
| MonoisotopicMass | 433.023226 |
| CLogP | 4.0058 |
| CLogS | -6.893 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 314.71 |
| Relative PSA | 0.28769 |
| PolarSurfaceArea | 109.65 |
| Druglikeness | 1.3799 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2,4-dichlorophenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(2,4-dichlorophenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide