| MolName | (5Z)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| MolecularFormula | C17H5N2OCl2F5S2 |
| Smiles | O=C(/C(/SC1=S)=C/c(c(F)c(c(F)c2F)F)c2F)N1/N=C\c(ccc(Cl)c1)c1Cl |
| InChI | InChI=1S/C17H5Cl2F5N2OS2/c18-7-2-1-6(9(19)3-7)5-25-26-16(27)10(29-17(26)28)4-8-11(20)13(22)15(24)14(23)12(8)21/h1-5H |
| InChIK | KYJDTPHDNJINLB-UHFFFAOYSA-N |
| TotalMolweight | 483.268 |
| Molweight | 483.268 |
| MonoisotopicMass | 481.914047 |
| CLogP | 4.7712 |
| CLogS | -8.137 |
| H Acceptors | 3 |
| TotalSurfaceArea | 309.83 |
| Relative PSA | 0.23752 |
| PolarSurfaceArea | 90.06 |
| Druglikeness | 3.5266 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; polyhalo aromatic ring |
| Shape Index | 0.55172 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - (5Z)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one | 2 - (5Z)-3-[(Z)-(2,4-dichlorophenyl)methylideneamino]-5-[(2,3,4,5,6-pentafluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one