| MolName | (2Z)-2-(diaminomethylidenehydrazinylidene)acetic acid |
| MolecularFormula | C3H6N4O2 |
| Smiles | NC(N)=N/N=C\C(O)=O |
| InChI | InChI=1S/C3H6N4O2/c4-3(5)7-6-1-2(8)9/h1H,(H,8,9)(H4,4,5,7) |
| InChIK | KYJNVSMTPGUARM-UHFFFAOYSA-N |
| TotalMolweight | 130.107 |
| Molweight | 130.107 |
| MonoisotopicMass | 130.049076 |
| CLogP | -1.7742 |
| CLogS | -1.217 |
| H Acceptors | 6 |
| H Donors | 3 |
| TotalSurfaceArea | 102.37 |
| Relative PSA | 0.77855 |
| PolarSurfaceArea | 114.06 |
| Druglikeness | 1.2231 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.77778 |
| Fragments | 1 |
| Non HAtoms | 9 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 2 |
| Sp3Atoms | 1 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (2Z)-2-(diaminomethylidenehydrazinylidene)acetic acid | 2 - (2Z)-2-(diaminomethylidenehydrazinylidene)acetic acid