| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide |
| MolecularFormula | C19H16N6O4S |
| Smiles | O=C(Cc1nnc(NC(Nc2ccccc2)=O)s1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C19H16N6O4S/c26-16(23-20-10-12-6-7-14-15(8-12)29-11-28-14)9-17-24-25-19(30-17)22-18(27)21-13-4-2-1-3-5-13/h1-8,10H,9,11H2,(H,23,26)(H2,21,22,25,27) |
| InChIK | KYNDGUGULSBJMA-UHFFFAOYSA-N |
| TotalMolweight | 424.44 |
| Molweight | 424.44 |
| MonoisotopicMass | 424.095374 |
| CLogP | 3.2955 |
| CLogS | -5.632 |
| H Acceptors | 10 |
| H Donors | 3 |
| TotalSurfaceArea | 314.9 |
| Relative PSA | 0.42639 |
| PolarSurfaceArea | 155.07 |
| Druglikeness | 6.3728 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Amides | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-2-[5-(phenylcarbamoylamino)-1,3,4-thiadiazol-2-yl]acetamide