| MolName | N-[(Z)-furan-2-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C18H25N7O |
| Smiles | C(CC1)CCN1c1nc(N/N=C\c2ccco2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C18H25N7O/c1-3-9-24(10-4-1)17-20-16(23-19-14-15-8-7-13-26-15)21-18(22-17)25-11-5-2-6-12-25/h7-8,13-14H,1-6,9-12H2,(H,20,21,22,23) |
| InChIK | KYNKNROVOLXNFQ-UHFFFAOYSA-N |
| TotalMolweight | 355.445 |
| Molweight | 355.445 |
| MonoisotopicMass | 355.212058 |
| CLogP | 5.1172 |
| CLogS | -5.001 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 286.41 |
| Relative PSA | 0.26916 |
| PolarSurfaceArea | 82.68 |
| Druglikeness | 2.2189 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 10 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-furan-2-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-furan-2-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine