| MolName | 4-[(3,4-dichlorophenyl)methoxy]-N-[(Z)-(2-phenoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C27H20N2O3Cl2 |
| Smiles | O=C(c(cc1)ccc1OCc(cc1)cc(Cl)c1Cl)N/N=C\c(cccc1)c1Oc1ccccc1 |
| InChI | InChI=1S/C27H20Cl2N2O3/c28-24-15-10-19(16-25(24)29)18-33-22-13-11-20(12-14-22)27(32)31-30-17-21-6-4-5-9-26(21)34-23-7-2-1-3-8-23/h1-17H,18H2,(H,31,32) |
| InChIK | KYPVXYPSJVCWGM-UHFFFAOYSA-N |
| TotalMolweight | 491.373 |
| Molweight | 491.373 |
| MonoisotopicMass | 490.085097 |
| CLogP | 7.1573 |
| CLogS | -8.831 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 371.11 |
| Relative PSA | 0.15093 |
| PolarSurfaceArea | 59.92 |
| Druglikeness | 4.0514 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(3,4-dichlorophenyl)methoxy]-N-[(Z)-(2-phenoxyphenyl)methylideneamino]benzamide | 2 - 4-[(3,4-dichlorophenyl)methoxy]-N-[(Z)-(2-phenoxyphenyl)methylideneamino]benzamide